CAS 1894568-91-2 is the registry number for D-Glutamic acid alpha-amide hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
(4R)-4,5-diamino-5-oxopentanoic acid;hydrochloride (CAS 1894568-91-2) is a chemical compound with the molecular formula C5H11ClN2O3 and a molecular weight of 182.60 g/mol. IUPAC name: (4R)-4,5-diamino-5-oxopentanoic acid;hydrochloride. InChIKey: QQZFNVIRTSLEGO-AENDTGMFSA-N.
| Molecular formula | C5H11ClN2O3 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | (4R)-4,5-diamino-5-oxopentanoic acid;hydrochloride |
| InChIKey | QQZFNVIRTSLEGO-AENDTGMFSA-N |
| SMILES | C(CC(=O)O)[C@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)