Products 1894568-91-2

CAS 1894568-91-2 is the registry number for D-Glutamic acid alpha-amide hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(4R)-4,5-diamino-5-oxopentanoic acid;hydrochloride (CAS 1894568-91-2) is a chemical compound with the molecular formula C5H11ClN2O3 and a molecular weight of 182.60 g/mol. IUPAC name: (4R)-4,5-diamino-5-oxopentanoic acid;hydrochloride. InChIKey: QQZFNVIRTSLEGO-AENDTGMFSA-N.

Identity
Molecular formulaC5H11ClN2O3
Molecular weight182.60 g/mol
IUPAC name(4R)-4,5-diamino-5-oxopentanoic acid;hydrochloride
InChIKeyQQZFNVIRTSLEGO-AENDTGMFSA-N
SMILESC(CC(=O)O)[C@H](C(=O)N)N.Cl

Computed by PubChem (NCBI)