Products 1272794-44-1
CAS 1272794-44-1 is the registry number for 3-Methyl-1-(2-(thiophen-3-yl)acetyl)pyrrolidine-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-1-(2-thiophen-3-ylacetyl)pyrrolidine-3-carboxylic acid (CAS 1272794-44-1) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. IUPAC name: 3-methyl-1-(2-thiophen-3-ylacetyl)pyrrolidine-3-carboxylic acid. InChIKey: SFEPYZMYDUUAMA-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 3-methyl-1-(2-thiophen-3-ylacetyl)pyrrolidine-3-carboxylic acid |
| InChIKey | SFEPYZMYDUUAMA-UHFFFAOYSA-N |
| SMILES | CC1(CCN(C1)C(=O)CC2=CSC=C2)C(=O)O |
Computed by PubChem (NCBI)