CAS 127289-95-6 is the registry number for ONO-RS-082 97%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-chloro-2-[[(E)-3-(4-pentylphenyl)prop-2-enoyl]amino]benzoic acid (CAS 127289-95-6) is a chemical compound with the molecular formula C21H22ClNO3 and a molecular weight of 371.9 g/mol. IUPAC name: 4-chloro-2-[[(E)-3-(4-pentylphenyl)prop-2-enoyl]amino]benzoic acid. InChIKey: MDVFITMPFHDRBZ-JLHYYAGUSA-N.
| Molecular formula | C21H22ClNO3 |
|---|---|
| Molecular weight | 371.9 g/mol |
| IUPAC name | 4-chloro-2-[[(E)-3-(4-pentylphenyl)prop-2-enoyl]amino]benzoic acid |
| InChIKey | MDVFITMPFHDRBZ-JLHYYAGUSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)/C=C/C(=O)NC2=C(C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)