Products 127289-95-6

CAS 127289-95-6 is the registry number for ONO-RS-082 97%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-chloro-2-[[(E)-3-(4-pentylphenyl)prop-2-enoyl]amino]benzoic acid (CAS 127289-95-6) is a chemical compound with the molecular formula C21H22ClNO3 and a molecular weight of 371.9 g/mol. IUPAC name: 4-chloro-2-[[(E)-3-(4-pentylphenyl)prop-2-enoyl]amino]benzoic acid. InChIKey: MDVFITMPFHDRBZ-JLHYYAGUSA-N.

Identity
Molecular formulaC21H22ClNO3
Molecular weight371.9 g/mol
IUPAC name4-chloro-2-[[(E)-3-(4-pentylphenyl)prop-2-enoyl]amino]benzoic acid
InChIKeyMDVFITMPFHDRBZ-JLHYYAGUSA-N
SMILESCCCCCC1=CC=C(C=C1)/C=C/C(=O)NC2=C(C=CC(=C2)Cl)C(=O)O

Computed by PubChem (NCBI)