CAS 1273550-42-7 appears in our catalog under these names: 2-Chloro-6-(4-fluorophenyl)pyrazine, 95%, 2–Chloro–6–(4–fluorophenyl)pyrazine, 2-chloro-6-(4-fluorophenyl)pyrazine. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg, 0,5g, 50mg.
2-chloro-6-(4-fluorophenyl)pyrazine (CAS 1273550-42-7) is a chemical compound with the molecular formula C10H6ClFN2 and a molecular weight of 208.62 g/mol. IUPAC name: 2-chloro-6-(4-fluorophenyl)pyrazine. InChIKey: QPCFEOIGFLYWAH-UHFFFAOYSA-N.
| Molecular formula | C10H6ClFN2 |
|---|---|
| Molecular weight | 208.62 g/mol |
| IUPAC name | 2-chloro-6-(4-fluorophenyl)pyrazine |
| InChIKey | QPCFEOIGFLYWAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=CC(=N2)Cl)F |
Computed by PubChem (NCBI)