Products 870221-45-7
CAS 870221-45-7 is the registry number for 2-Chloro-2'-fluoro-3,4'-bipyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-3-(2-fluoro-4-pyridinyl)pyridine (CAS 870221-45-7) is a chemical compound with the molecular formula C10H6ClFN2 and a molecular weight of 208.62 g/mol. IUPAC name: 2-chloro-3-(2-fluoro-4-pyridinyl)pyridine. InChIKey: AHZUKRIVCWRDDN-UHFFFAOYSA-N.
| Molecular formula | C10H6ClFN2 |
|---|---|
| Molecular weight | 208.62 g/mol |
| IUPAC name | 2-chloro-3-(2-fluoro-4-pyridinyl)pyridine |
| InChIKey | AHZUKRIVCWRDDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)C2=CC(=NC=C2)F |
Computed by PubChem (NCBI)