CAS 85979-60-8 is the registry number for 4-Chloro-6-(3-fluorophenyl)pyrimidine 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-chloro-6-(3-fluorophenyl)pyrimidine (CAS 85979-60-8) is a chemical compound with the molecular formula C10H6ClFN2 and a molecular weight of 208.62 g/mol. IUPAC name: 4-chloro-6-(3-fluorophenyl)pyrimidine. InChIKey: HFGCFWZSUWARQE-UHFFFAOYSA-N.
| Molecular formula | C10H6ClFN2 |
|---|---|
| Molecular weight | 208.62 g/mol |
| IUPAC name | 4-chloro-6-(3-fluorophenyl)pyrimidine |
| InChIKey | HFGCFWZSUWARQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC(=NC=N2)Cl |
Computed by PubChem (NCBI)