Products 942206-11-3
CAS 942206-11-3 is the registry number for 5-Chloro-2'-fluoro-2,4'-bipyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
4-(5-chloro-2-pyridinyl)-2-fluoropyridine (CAS 942206-11-3) is a chemical compound with the molecular formula C10H6ClFN2 and a molecular weight of 208.62 g/mol. IUPAC name: 4-(5-chloro-2-pyridinyl)-2-fluoropyridine. InChIKey: UCTHNJGQZMBIOJ-UHFFFAOYSA-N.
| Molecular formula | C10H6ClFN2 |
|---|---|
| Molecular weight | 208.62 g/mol |
| IUPAC name | 4-(5-chloro-2-pyridinyl)-2-fluoropyridine |
| InChIKey | UCTHNJGQZMBIOJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)C2=CC(=NC=C2)F |
Computed by PubChem (NCBI)