CAS 1273611-01-0 appears in our catalog under these names: 5–Bromo–7–chloro–2,3–dihydro–1H–inden–1–one, 5-Bromo-7-chloro-2,3-dihydro-1H-inden-1-one, 95%, 95%, 5-Bromo-7-chloro-2,3-dihydro-1H-inden-1-one, 97%, 5-Bromo-7-chloro-2,3-dihydro-1H-inden-1-one, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 500mg, 25g.
5-bromo-7-chloro-2,3-dihydroinden-1-one (CAS 1273611-01-0) is a chemical compound with the molecular formula C9H6BrClO and a molecular weight of 245.50 g/mol. IUPAC name: 5-bromo-7-chloro-2,3-dihydroinden-1-one. InChIKey: FPRQFNQYLBNEOH-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClO |
|---|---|
| Molecular weight | 245.50 g/mol |
| IUPAC name | 5-bromo-7-chloro-2,3-dihydroinden-1-one |
| InChIKey | FPRQFNQYLBNEOH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=C(C=C2Cl)Br |
Computed by PubChem (NCBI)