CAS 1275071-39-0 appears in our catalog under these names: 3-(4-Bromophenoxy)-1-methyl-1,2-dihydropyrazin-2-one, 98%, 3-(4-Bromophenoxy)-1-methyl-1,2-dihydropyrazin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(4-bromophenoxy)-1-methylpyrazin-2-one (CAS 1275071-39-0) is a chemical compound with the molecular formula C11H9BrN2O2 and a molecular weight of 281.10 g/mol. IUPAC name: 3-(4-bromophenoxy)-1-methylpyrazin-2-one. InChIKey: FKAFHDLJLGIIFF-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O2 |
|---|---|
| Molecular weight | 281.10 g/mol |
| IUPAC name | 3-(4-bromophenoxy)-1-methylpyrazin-2-one |
| InChIKey | FKAFHDLJLGIIFF-UHFFFAOYSA-N |
| SMILES | CN1C=CN=C(C1=O)OC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)