CAS 127510-98-9 appears in our catalog under these names: Methyl 2-cyano-6-methylbenzoate, 95%, Methyl 2–cyano–6–methylbenzoate, Methyl 2-cyano-6-methylbenzoate, 95%, 95%, Methyl 2-cyano-6-methylbenzoate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
Methyl 2-cyano-6-methylbenzoate (CAS 127510-98-9) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: methyl 2-cyano-6-methylbenzoate. InChIKey: OVCFEGUYKGFRQT-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | methyl 2-cyano-6-methylbenzoate |
| InChIKey | OVCFEGUYKGFRQT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C#N)C(=O)OC |
Computed by PubChem (NCBI)