Products 1276297-68-7
CAS 1276297-68-7 appears in our catalog under these names: Thiorphan-d7, >95% (HPLC), Thiorphan-d7. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 5mg, 25mg, 10 mg, 1 mg.
2-[[3,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)-2-(sulfanylmethyl)propanoyl]amino]acetic acid (CAS 1276297-68-7) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 260.36 g/mol. IUPAC name: 2-[[3,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)-2-(sulfanylmethyl)propanoyl]amino]acetic acid. InChIKey: LJJKNPQAGWVLDQ-XZJKGWKKSA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 260.36 g/mol |
| IUPAC name | 2-[[3,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)-2-(sulfanylmethyl)propanoyl]amino]acetic acid |
| InChIKey | LJJKNPQAGWVLDQ-XZJKGWKKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C(CS)C(=O)NCC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)