Products 2183240-70-0
CAS 2183240-70-0 appears in our catalog under these names: Thiorphan–d5, Thiorphan-d5. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5 mg, 1 mg, 500 μg.
2-[[2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]-3-sulfanylpropanoyl]amino]acetic acid (CAS 2183240-70-0) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 258.35 g/mol. IUPAC name: 2-[[2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]-3-sulfanylpropanoyl]amino]acetic acid. InChIKey: LJJKNPQAGWVLDQ-RALIUCGRSA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 258.35 g/mol |
| IUPAC name | 2-[[2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]-3-sulfanylpropanoyl]amino]acetic acid |
| InChIKey | LJJKNPQAGWVLDQ-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CC(CS)C(=O)NCC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)