CAS 127708-38-7 is the registry number for (R)-β-Fluorophenethylamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2R)-2-fluoro-2-phenylethanamine;hydrochloride (CAS 127708-38-7) is a chemical compound with the molecular formula C8H11ClFN and a molecular weight of 175.63 g/mol. IUPAC name: (2R)-2-fluoro-2-phenylethanamine;hydrochloride. InChIKey: ULMDYGAIJJWADH-QRPNPIFTSA-N.
| Molecular formula | C8H11ClFN |
|---|---|
| Molecular weight | 175.63 g/mol |
| IUPAC name | (2R)-2-fluoro-2-phenylethanamine;hydrochloride |
| InChIKey | ULMDYGAIJJWADH-QRPNPIFTSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CN)F.Cl |
Computed by PubChem (NCBI)