CAS 1277178-25-2 is the registry number for 3-Methyl-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-8-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-8-amine (CAS 1277178-25-2) is a chemical compound with the molecular formula C8H7F3N4 and a molecular weight of 216.16 g/mol. IUPAC name: 3-methyl-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-8-amine. InChIKey: NLURBAOSQUZLNQ-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N4 |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 3-methyl-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-8-amine |
| InChIKey | NLURBAOSQUZLNQ-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C=C(C=C2N)C(F)(F)F |
Computed by PubChem (NCBI)