CAS 198953-59-2 is the registry number for 5,7-Dimethyl-2-(trifluoromethyl)-(1,2,4)triazolo(1,5-a)pyrimidine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 198953-59-2) is a chemical compound with the molecular formula C8H7F3N4 and a molecular weight of 216.16 g/mol. IUPAC name: 5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: IHSMPJDCZJSOOE-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N4 |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | IHSMPJDCZJSOOE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NC(=NN12)C(F)(F)F)C |
Computed by PubChem (NCBI)