CAS 889943-45-7 appears in our catalog under these names: 1-(6-(trifluoromethyl)-(1,2,4)triazolo(4,3-a)pyridin-3-yl)methanamine, 98%, (6-(Trifluoromethyl)-(1,2,4)triazolo(4,3-a)pyridin-3-yl)methanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 100mg, 10g, 1g.
[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methanamine (CAS 889943-45-7) is a chemical compound with the molecular formula C8H7F3N4 and a molecular weight of 216.16 g/mol. IUPAC name: [6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methanamine. InChIKey: CVLCFENWSHXLIH-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N4 |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | [6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methanamine |
| InChIKey | CVLCFENWSHXLIH-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN=C(N2C=C1C(F)(F)F)CN |
Computed by PubChem (NCBI)