CAS 832740-69-9 appears in our catalog under these names: 4-Methyl-6-(trifluoromethyl)-1h-pyrazolo[3,4-b]pyridin-3-amine, 95%, 4-Methyl-6-(trifluoromethyl)-1H-pyrazolo(3,4-b)pyridin-3-amine, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg, 10g, 5g.
4-methyl-6-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine (CAS 832740-69-9) is a chemical compound with the molecular formula C8H7F3N4 and a molecular weight of 216.16 g/mol. IUPAC name: 4-methyl-6-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine. InChIKey: QCLRUMJLPRWXLA-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N4 |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 4-methyl-6-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-3-amine |
| InChIKey | QCLRUMJLPRWXLA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NNC(=C12)N)C(F)(F)F |
Computed by PubChem (NCBI)