Products 127769-55-5
CAS 127769-55-5 is the registry number for 5-Bromonaphthalene-2-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromonaphthalene-2-sulfonyl chloride (CAS 127769-55-5) is a chemical compound with the molecular formula C10H6BrClO2S and a molecular weight of 305.58 g/mol. IUPAC name: 5-bromonaphthalene-2-sulfonyl chloride. InChIKey: OFQOEYBXLJPJOV-UHFFFAOYSA-N.
| Molecular formula | C10H6BrClO2S |
|---|---|
| Molecular weight | 305.58 g/mol |
| IUPAC name | 5-bromonaphthalene-2-sulfonyl chloride |
| InChIKey | OFQOEYBXLJPJOV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)S(=O)(=O)Cl)C(=C1)Br |
Computed by PubChem (NCBI)