CAS 50637-98-4 is the registry number for 6-Bromonaphthalene-2-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,1g, 0,05g, 0,25g, 0,5g, 1g.
6-bromonaphthalene-2-sulfonyl chloride (CAS 50637-98-4) is a chemical compound with the molecular formula C10H6BrClO2S and a molecular weight of 305.58 g/mol. IUPAC name: 6-bromonaphthalene-2-sulfonyl chloride. InChIKey: RDKORFDRILIBOL-UHFFFAOYSA-N.
| Molecular formula | C10H6BrClO2S |
|---|---|
| Molecular weight | 305.58 g/mol |
| IUPAC name | 6-bromonaphthalene-2-sulfonyl chloride |
| InChIKey | RDKORFDRILIBOL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)