CAS 63279-36-7 appears in our catalog under these names: 4-Bromonaphthalene-1-sulfonyl chloride 95%, 4-Bromo-naphthalene-1-sulfonyl chloride, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-bromonaphthalene-1-sulfonyl chloride (CAS 63279-36-7) is a chemical compound with the molecular formula C10H6BrClO2S and a molecular weight of 305.58 g/mol. IUPAC name: 4-bromonaphthalene-1-sulfonyl chloride. InChIKey: MNBFYZPSEJKTFA-UHFFFAOYSA-N.
| Molecular formula | C10H6BrClO2S |
|---|---|
| Molecular weight | 305.58 g/mol |
| IUPAC name | 4-bromonaphthalene-1-sulfonyl chloride |
| InChIKey | MNBFYZPSEJKTFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)