Products 2133820-21-8

CAS 2133820-21-8 is the registry number for 5-Bromo-6-chloro-benzo[b]thiophene-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 5-bromo-6-chloro-1-benzothiophene-2-carboxylate (CAS 2133820-21-8) is a chemical compound with the molecular formula C10H6BrClO2S and a molecular weight of 305.58 g/mol. IUPAC name: methyl 5-bromo-6-chloro-1-benzothiophene-2-carboxylate. InChIKey: FNONFHFYJYNMNU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6BrClO2S
Molecular weight305.58 g/mol
IUPAC namemethyl 5-bromo-6-chloro-1-benzothiophene-2-carboxylate
InChIKeyFNONFHFYJYNMNU-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=CC(=C(C=C2S1)Cl)Br

Computed by PubChem (NCBI)