Products 1279035-36-7
CAS 1279035-36-7 appears in our catalog under these names: Ribavirin-13C2, >95% (HPLC), Ribavirin-13C2. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-(313C)1,2,4-triazole-3-carboxamide (CAS 1279035-36-7) is a chemical compound with the molecular formula C8H12N4O5 and a molecular weight of 246.19 g/mol. IUPAC name: 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-(313C)1,2,4-triazole-3-carboxamide. InChIKey: IWUCXVSUMQZMFG-XHJYHLGGSA-N.
| Molecular formula | C8H12N4O5 |
|---|---|
| Molecular weight | 246.19 g/mol |
| IUPAC name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-(313C)1,2,4-triazole-3-carboxamide |
| InChIKey | IWUCXVSUMQZMFG-XHJYHLGGSA-N |
| SMILES | C1=N[13C](=NN1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)[13C](=O)N |
Computed by PubChem (NCBI)
Synonyms:
Ribavirin-13C2, Ribavirin-