CAS 206269-46-7 appears in our catalog under these names: Azacitidine Impurity 37, Azacitidine Impurity O, Azacitidine Impurity 21. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-amino-1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one (CAS 206269-46-7) is a chemical compound with the molecular formula C8H12N4O5 and a molecular weight of 244.20 g/mol. IUPAC name: 4-amino-1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one. InChIKey: NMUSYJAQQFHJEW-BXKVDMCESA-N.
| Molecular formula | C8H12N4O5 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | 4-amino-1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| InChIKey | NMUSYJAQQFHJEW-BXKVDMCESA-N |
| SMILES | C1=NC(=NC(=O)N1[C@@H]2[C@H]([C@H]([C@@H](O2)CO)O)O)N |
Computed by PubChem (NCBI)