CAS 39030-43-8 appears in our catalog under these names: 1-((2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1H-1,2,4-triazole-5-carboxamide, 98%, Ribavirin EP Impurity G, Iso Ribavirin (Ribavirin Impurity G), >95% (HPLC), Isoribavirin. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 1mg, 2mg, 5mg.
2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide (CAS 39030-43-8) is a chemical compound with the molecular formula C8H12N4O5 and a molecular weight of 244.20 g/mol. IUPAC name: 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide. InChIKey: HAMRZKKGAOJPDG-AFCXAGJDSA-N.
| Molecular formula | C8H12N4O5 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| InChIKey | HAMRZKKGAOJPDG-AFCXAGJDSA-N |
| SMILES | C1=NN(C(=N1)C(=O)N)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)