CAS 3131-60-0 is the registry number for 6-Azacytidine. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 100mg, 10mg.
5-amino-2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazin-3-one (CAS 3131-60-0) is a chemical compound with the molecular formula C8H12N4O5 and a molecular weight of 244.20 g/mol. IUPAC name: 5-amino-2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazin-3-one. InChIKey: OZQDLJNDRVBCST-SHUUEZRQSA-N.
| Molecular formula | C8H12N4O5 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | 5-amino-2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazin-3-one |
| InChIKey | OZQDLJNDRVBCST-SHUUEZRQSA-N |
| SMILES | C1=NN(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)