CAS 1279039-34-7 appears in our catalog under these names: (2R,4S)-tert-Butyl 4-amino-2-(hydroxymethyl)pyrrolidine-1-carboxylate hydrochloride, 95%, 95%, (2R,4S)-tert-Butyl 4-amino-2-(hydroxymethyl)pyrrolidine-1-carboxylate hydrochloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl (2R,4S)-4-amino-2-(hydroxymethyl)pyrrolidine-1-carboxylate;hydrochloride (CAS 1279039-34-7) is a chemical compound with the molecular formula C10H21ClN2O3 and a molecular weight of 252.74 g/mol. IUPAC name: tert-butyl (2R,4S)-4-amino-2-(hydroxymethyl)pyrrolidine-1-carboxylate;hydrochloride. InChIKey: CBLODQXSQDSMHU-KZYPOYLOSA-N.
| Molecular formula | C10H21ClN2O3 |
|---|---|
| Molecular weight | 252.74 g/mol |
| IUPAC name | tert-butyl (2R,4S)-4-amino-2-(hydroxymethyl)pyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | CBLODQXSQDSMHU-KZYPOYLOSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1CO)N.Cl |
Computed by PubChem (NCBI)