Products 1279569-17-3
CAS 1279569-17-3 is the registry number for 3-Azabicyclo[3.1.0]hexane-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1R,5S)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (CAS 1279569-17-3) is a chemical compound with the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. IUPAC name: (1R,5S)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid. InChIKey: JBDOTWVUXVXVDR-ZZKAVYKESA-N.
| Molecular formula | C6H9NO2 |
|---|---|
| Molecular weight | 127.14 g/mol |
| IUPAC name | (1R,5S)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| InChIKey | JBDOTWVUXVXVDR-ZZKAVYKESA-N |
| SMILES | C1[C@H]2[C@@H]1C(NC2)C(=O)O |
Computed by PubChem (NCBI)