Products 33294-81-4

CAS 33294-81-4 is the registry number for Proline Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(1R,2S,5S)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (CAS 33294-81-4) is a chemical compound with the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. IUPAC name: (1R,2S,5S)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid. InChIKey: JBDOTWVUXVXVDR-WDCZJNDASA-N.

Identity
Molecular formulaC6H9NO2
Molecular weight127.14 g/mol
IUPAC name(1R,2S,5S)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid
InChIKeyJBDOTWVUXVXVDR-WDCZJNDASA-N
SMILESC1[C@H]2[C@@H]1[C@H](NC2)C(=O)O

Computed by PubChem (NCBI)