CAS 72029-78-8 is the registry number for (1R,2R,5S)-Rel-3-azabicyclo[3.1.0]hexane-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (CAS 72029-78-8) is a chemical compound with the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. IUPAC name: (1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid. InChIKey: JBDOTWVUXVXVDR-YUPRTTJUSA-N.
| Molecular formula | C6H9NO2 |
|---|---|
| Molecular weight | 127.14 g/mol |
| IUPAC name | (1S,2S,5R)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| InChIKey | JBDOTWVUXVXVDR-YUPRTTJUSA-N |
| SMILES | C1[C@@H]2[C@H]1[C@H](NC2)C(=O)O |
Computed by PubChem (NCBI)