CAS 127977-72-4 is the registry number for 2-Amino-5,6-dibromobenzothiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
5,6-dibromo-1,3-benzothiazol-2-amine (CAS 127977-72-4) is a chemical compound with the molecular formula C7H4Br2N2S and a molecular weight of 308.00 g/mol. IUPAC name: 5,6-dibromo-1,3-benzothiazol-2-amine. InChIKey: VMXXRQMNZGDNJV-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2S |
|---|---|
| Molecular weight | 308.00 g/mol |
| IUPAC name | 5,6-dibromo-1,3-benzothiazol-2-amine |
| InChIKey | VMXXRQMNZGDNJV-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)Br)SC(=N2)N |
Computed by PubChem (NCBI)