Products 2450989-99-6
CAS 2450989-99-6 is the registry number for 5-Bromo-3-(bromomethyl)isothiazolo[5,4-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-(bromomethyl)-[1,2]thiazolo[5,4-b]pyridine (CAS 2450989-99-6) is a chemical compound with the molecular formula C7H4Br2N2S and a molecular weight of 308.00 g/mol. IUPAC name: 5-bromo-3-(bromomethyl)-[1,2]thiazolo[5,4-b]pyridine. InChIKey: YVBWFVYQFYCBKH-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2S |
|---|---|
| Molecular weight | 308.00 g/mol |
| IUPAC name | 5-bromo-3-(bromomethyl)-[1,2]thiazolo[5,4-b]pyridine |
| InChIKey | YVBWFVYQFYCBKH-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=NS2)CBr)Br |
Computed by PubChem (NCBI)