CAS 771-11-9 is the registry number for 5,7–Dibromobenzo(d)thiazol–4–amine. Offered by: GLPBio. Available pack sizes: 100mg.
5,7-dibromo-1,3-benzothiazol-4-amine (CAS 771-11-9) is a chemical compound with the molecular formula C7H4Br2N2S and a molecular weight of 308.00 g/mol. IUPAC name: 5,7-dibromo-1,3-benzothiazol-4-amine. InChIKey: GJHULBALZUQYOX-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2S |
|---|---|
| Molecular weight | 308.00 g/mol |
| IUPAC name | 5,7-dibromo-1,3-benzothiazol-4-amine |
| InChIKey | GJHULBALZUQYOX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C2C(=C1Br)SC=N2)N)Br |
Computed by PubChem (NCBI)