CAS 151869-78-2 is the registry number for 4-(Dibromomethyl)benzo[c][1,2,5]thiadiazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(dibromomethyl)-2,1,3-benzothiadiazole (CAS 151869-78-2) is a chemical compound with the molecular formula C7H4Br2N2S and a molecular weight of 308.00 g/mol. IUPAC name: 4-(dibromomethyl)-2,1,3-benzothiadiazole. InChIKey: MPVCSKUEENTIJY-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2S |
|---|---|
| Molecular weight | 308.00 g/mol |
| IUPAC name | 4-(dibromomethyl)-2,1,3-benzothiadiazole |
| InChIKey | MPVCSKUEENTIJY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C(=C1)C(Br)Br |
Computed by PubChem (NCBI)