Products 1279818-57-3
CAS 1279818-57-3 is the registry number for tert-Butyl 2-(6-chloropyridin-2-yl)-2-cyanoacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Tert-butyl 2-(6-chloro-2-pyridinyl)-2-cyanoacetate (CAS 1279818-57-3) is a chemical compound with the molecular formula C12H13ClN2O2 and a molecular weight of 252.69 g/mol. IUPAC name: tert-butyl 2-(6-chloro-2-pyridinyl)-2-cyanoacetate. InChIKey: XMYHFDDVUXQKKW-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O2 |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | tert-butyl 2-(6-chloro-2-pyridinyl)-2-cyanoacetate |
| InChIKey | XMYHFDDVUXQKKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C#N)C1=NC(=CC=C1)Cl |
Computed by PubChem (NCBI)