CAS 2413365-43-0 is the registry number for tert-Butyl (R)-6-amino-2-azaspiro[3.4]octane-2-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (6R)-6-amino-2-azaspiro[3.4]octane-2-carboxylate;hydrochloride (CAS 2413365-43-0) is a chemical compound with the molecular formula C12H23ClN2O2 and a molecular weight of 262.77 g/mol. IUPAC name: tert-butyl (6R)-6-amino-2-azaspiro[3.4]octane-2-carboxylate;hydrochloride. InChIKey: FFKCPVBIFUVAJW-SBSPUUFOSA-N.
| Molecular formula | C12H23ClN2O2 |
|---|---|
| Molecular weight | 262.77 g/mol |
| IUPAC name | tert-butyl (6R)-6-amino-2-azaspiro[3.4]octane-2-carboxylate;hydrochloride |
| InChIKey | FFKCPVBIFUVAJW-SBSPUUFOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC[C@H](C2)N.Cl |
Computed by PubChem (NCBI)