CAS 1280602-81-4 is the registry number for Erythro-1-(4-hydroxy-3-methoxyphenyl)propane-1,2-diol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
(1S,2R)-1-(4-hydroxy-3-methoxyphenyl)propane-1,2-diol (CAS 1280602-81-4) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: (1S,2R)-1-(4-hydroxy-3-methoxyphenyl)propane-1,2-diol. InChIKey: PZKYCBMLUGVAGH-LHLIQPBNSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (1S,2R)-1-(4-hydroxy-3-methoxyphenyl)propane-1,2-diol |
| InChIKey | PZKYCBMLUGVAGH-LHLIQPBNSA-N |
| SMILES | C[C@H]([C@H](C1=CC(=C(C=C1)O)OC)O)O |
Computed by PubChem (NCBI)