CAS 1280673-16-6 is the registry number for Methyl 2-(3,5-dimethyl-1-(pyridin-2-yl)-1H-pyrazol-4-yl)propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)propanoate (CAS 1280673-16-6) is a chemical compound with the molecular formula C14H17N3O2 and a molecular weight of 259.30 g/mol. IUPAC name: methyl 2-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)propanoate. InChIKey: NTABNDJETRSZMQ-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O2 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | methyl 2-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)propanoate |
| InChIKey | NTABNDJETRSZMQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=N2)C)C(C)C(=O)OC |
Computed by PubChem (NCBI)