Products 1280673-16-6

CAS 1280673-16-6 is the registry number for Methyl 2-(3,5-dimethyl-1-(pyridin-2-yl)-1H-pyrazol-4-yl)propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)propanoate (CAS 1280673-16-6) is a chemical compound with the molecular formula C14H17N3O2 and a molecular weight of 259.30 g/mol. IUPAC name: methyl 2-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)propanoate. InChIKey: NTABNDJETRSZMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17N3O2
Molecular weight259.30 g/mol
IUPAC namemethyl 2-(3,5-dimethyl-1-pyridin-2-ylpyrazol-4-yl)propanoate
InChIKeyNTABNDJETRSZMQ-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1C2=CC=CC=N2)C)C(C)C(=O)OC

Computed by PubChem (NCBI)