CAS 1280786-85-7 is the registry number for 5-Bromo-1-butylindazole, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
5-bromo-1-butylindazole (CAS 1280786-85-7) is a chemical compound with the molecular formula C11H13BrN2 and a molecular weight of 253.14 g/mol. IUPAC name: 5-bromo-1-butylindazole. InChIKey: WZKCPFIDHKMCCK-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2 |
|---|---|
| Molecular weight | 253.14 g/mol |
| IUPAC name | 5-bromo-1-butylindazole |
| InChIKey | WZKCPFIDHKMCCK-UHFFFAOYSA-N |
| SMILES | CCCCN1C2=C(C=C(C=C2)Br)C=N1 |
Computed by PubChem (NCBI)