CAS 830-93-3 appears in our catalog under these names: 5-Bromogramine, 97%, 5-Bromogramine, 1-(5-Bromo-1H-indol-3-yl)-N,N-dimethylmethanamine, 98%, 98%, 1-(5-Bromo-1H-indol-3-yl)-N,N-dimethylmethanamine, 98%. Offered by: Combi-blocks, Thermo Scientific (Acros), Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 5 g, 10 g, 1 g, 100 mg.
1-(5-bromo-1H-indol-3-yl)-N,N-dimethylmethanamine (CAS 830-93-3) is a chemical compound with the molecular formula C11H13BrN2 and a molecular weight of 253.14 g/mol. IUPAC name: 1-(5-bromo-1H-indol-3-yl)-N,N-dimethylmethanamine. InChIKey: FSERHDPEOFYMMK-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2 |
|---|---|
| Molecular weight | 253.14 g/mol |
| IUPAC name | 1-(5-bromo-1H-indol-3-yl)-N,N-dimethylmethanamine |
| InChIKey | FSERHDPEOFYMMK-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CNC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)