CAS 904813-48-5 is the registry number for 3-Bromo-2-tert-butylimidazo[1,2-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g, 250mg.
3-bromo-2-tert-butylimidazo[1,2-a]pyridine (CAS 904813-48-5) is a chemical compound with the molecular formula C11H13BrN2 and a molecular weight of 253.14 g/mol. IUPAC name: 3-bromo-2-tert-butylimidazo[1,2-a]pyridine. InChIKey: IPHJVOCATFFPSZ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2 |
|---|---|
| Molecular weight | 253.14 g/mol |
| IUPAC name | 3-bromo-2-tert-butylimidazo[1,2-a]pyridine |
| InChIKey | IPHJVOCATFFPSZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(N2C=CC=CC2=N1)Br |
Computed by PubChem (NCBI)