CAS 59609-63-1 is the registry number for 6-Bromogramine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(6-bromo-1H-indol-3-yl)-N,N-dimethylmethanamine (CAS 59609-63-1) is a chemical compound with the molecular formula C11H13BrN2 and a molecular weight of 253.14 g/mol. IUPAC name: 1-(6-bromo-1H-indol-3-yl)-N,N-dimethylmethanamine. InChIKey: CKUNQRCQLWHINE-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2 |
|---|---|
| Molecular weight | 253.14 g/mol |
| IUPAC name | 1-(6-bromo-1H-indol-3-yl)-N,N-dimethylmethanamine |
| InChIKey | CKUNQRCQLWHINE-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CNC2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)