CAS 128136-94-7 appears in our catalog under these names: Voriconazole Impurity 71, N-[(4-methoxyphenyl)methyl]cyclopropanesulfonamide, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg.
1-(4-fluorophenyl)-2-(1,2,4-triazol-4-yl)ethanone (CAS 128136-94-7) is a chemical compound with the molecular formula C10H8FN3O and a molecular weight of 205.19 g/mol. IUPAC name: 1-(4-fluorophenyl)-2-(1,2,4-triazol-4-yl)ethanone. InChIKey: LEJHQGNWSMPILM-UHFFFAOYSA-N.
| Molecular formula | C10H8FN3O |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2-(1,2,4-triazol-4-yl)ethanone |
| InChIKey | LEJHQGNWSMPILM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CN2C=NN=C2)F |
Computed by PubChem (NCBI)