CAS 941192-02-5 is the registry number for N-{(3-Fluoro-4-(1H-imidazol-1-yl)phenyl)methylidene}hydroxylamine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
(NE)-N-[(3-fluoro-4-imidazol-1-ylphenyl)methylidene]hydroxylamine (CAS 941192-02-5) is a chemical compound with the molecular formula C10H8FN3O and a molecular weight of 205.19 g/mol. IUPAC name: (NE)-N-[(3-fluoro-4-imidazol-1-ylphenyl)methylidene]hydroxylamine. InChIKey: VYGDSWUOSFKTKA-AWNIVKPZSA-N.
| Molecular formula | C10H8FN3O |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | (NE)-N-[(3-fluoro-4-imidazol-1-ylphenyl)methylidene]hydroxylamine |
| InChIKey | VYGDSWUOSFKTKA-AWNIVKPZSA-N |
| SMILES | C1=CC(=C(C=C1/C=N/O)F)N2C=CN=C2 |
Computed by PubChem (NCBI)