Products 96219-84-0
CAS 96219-84-0 is the registry number for (3-Amino-1H-pyrazol-4-yl)(4-fluorophenyl)methanone, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
(5-amino-1H-pyrazol-4-yl)-(4-fluorophenyl)methanone (CAS 96219-84-0) is a chemical compound with the molecular formula C10H8FN3O and a molecular weight of 205.19 g/mol. IUPAC name: (5-amino-1H-pyrazol-4-yl)-(4-fluorophenyl)methanone. InChIKey: SLDRSGCIYSROJJ-UHFFFAOYSA-N.
| Molecular formula | C10H8FN3O |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | (5-amino-1H-pyrazol-4-yl)-(4-fluorophenyl)methanone |
| InChIKey | SLDRSGCIYSROJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(NN=C2)N)F |
Computed by PubChem (NCBI)