CAS 58905-21-8 appears in our catalog under these names: 1-(4-Fluorophenyl)-2-(1h-1,2,4-triazole-1-yl)ethanone, 95%, Fluconazole Impurity 32, 1-(4-Fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone, 95+%, 95+%, 1-(4-Fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethan-1-one, 95+%. Offered by: Combi-blocks, Chemat Brand, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, on request.
1-(4-fluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone (CAS 58905-21-8) is a chemical compound with the molecular formula C10H8FN3O and a molecular weight of 205.19 g/mol. IUPAC name: 1-(4-fluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone. InChIKey: IKOAKIRZMHXFFT-UHFFFAOYSA-N.
| Molecular formula | C10H8FN3O |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
| InChIKey | IKOAKIRZMHXFFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CN2C=NC=N2)F |
Computed by PubChem (NCBI)