CAS 1281551-08-3 is the registry number for Ethyl 5-(3-methylphenyl)-1H-1,2,4-triazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 3-(3-methylphenyl)-1H-1,2,4-triazole-5-carboxylate (CAS 1281551-08-3) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: ethyl 3-(3-methylphenyl)-1H-1,2,4-triazole-5-carboxylate. InChIKey: CTCKIUPPHDTOES-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | ethyl 3-(3-methylphenyl)-1H-1,2,4-triazole-5-carboxylate |
| InChIKey | CTCKIUPPHDTOES-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NN1)C2=CC=CC(=C2)C |
Computed by PubChem (NCBI)