Products 1281554-27-5
CAS 1281554-27-5 appears in our catalog under these names: 5-(3-Acetylphenoxymethyl)-1,2-oxazole-3-carboxylic acid, 95%, 5-(3-Acetylphenoxymethyl)-1,2-oxazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-[(3-acetylphenoxy)methyl]-1,2-oxazole-3-carboxylic acid (CAS 1281554-27-5) is a chemical compound with the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. IUPAC name: 5-[(3-acetylphenoxy)methyl]-1,2-oxazole-3-carboxylic acid. InChIKey: IKUJGPJFLBFNCF-UHFFFAOYSA-N.
| Molecular formula | C13H11NO5 |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | 5-[(3-acetylphenoxy)methyl]-1,2-oxazole-3-carboxylic acid |
| InChIKey | IKUJGPJFLBFNCF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)OCC2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)