Products 1281643-36-4
CAS 1281643-36-4 is the registry number for 3-(5-Bromofuran-2-carboxamido)tetrahydrothiophene-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(5-bromofuran-2-carbonyl)amino]thiolane-3-carboxylic acid (CAS 1281643-36-4) is a chemical compound with the molecular formula C10H10BrNO4S and a molecular weight of 320.16 g/mol. IUPAC name: 3-[(5-bromofuran-2-carbonyl)amino]thiolane-3-carboxylic acid. InChIKey: LYDSADAFGZJUOE-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO4S |
|---|---|
| Molecular weight | 320.16 g/mol |
| IUPAC name | 3-[(5-bromofuran-2-carbonyl)amino]thiolane-3-carboxylic acid |
| InChIKey | LYDSADAFGZJUOE-UHFFFAOYSA-N |
| SMILES | C1CSCC1(C(=O)O)NC(=O)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)