CAS 852933-48-3 appears in our catalog under these names: 2-Bromo-5-[(cyclopropylamino)sulfonyl]benzoic acid, 95%, 2-Bromo-5-(N-cyclopropylsulfamoyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-bromo-5-(cyclopropylsulfamoyl)benzoic acid (CAS 852933-48-3) is a chemical compound with the molecular formula C10H10BrNO4S and a molecular weight of 320.16 g/mol. IUPAC name: 2-bromo-5-(cyclopropylsulfamoyl)benzoic acid. InChIKey: NGOFHWMILIWKFA-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO4S |
|---|---|
| Molecular weight | 320.16 g/mol |
| IUPAC name | 2-bromo-5-(cyclopropylsulfamoyl)benzoic acid |
| InChIKey | NGOFHWMILIWKFA-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC(=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)