Products 1540171-83-2
CAS 1540171-83-2 is the registry number for 3-Bromo-5-cyclopropanesulfonylamino-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-5-(cyclopropylsulfonylamino)benzoic acid (CAS 1540171-83-2) is a chemical compound with the molecular formula C10H10BrNO4S and a molecular weight of 320.16 g/mol. IUPAC name: 3-bromo-5-(cyclopropylsulfonylamino)benzoic acid. InChIKey: CVAMZXWDBRBCDZ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO4S |
|---|---|
| Molecular weight | 320.16 g/mol |
| IUPAC name | 3-bromo-5-(cyclopropylsulfonylamino)benzoic acid |
| InChIKey | CVAMZXWDBRBCDZ-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)NC2=CC(=CC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)